mucic acid


galactaric acid; mucic acid
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
CAS RN:[526-99-8]
Formula:C6H10O8; 210.14 g/mol
InChiKey:DSLZVSRJTYRBFB-UHFFFAOYSA-N
SMILES:OC(C(O)C(O)C(O)=O)C(O)C(O)=O
Molecular structure of mucic acid
Melting point:214 °C

Isomers

D-altraric acid
Molecular structure of D-altraric acid
L-altraric acid
Molecular structure of L-altraric acid
citric acid hydrate
Molecular structure of citric acid hydrate
glucaric acid
Molecular structure of glucaric acid
mucic acid
Molecular structure of mucic acid